Tyrosols and derivatives
Aobchem 1-(2 4-Dimethoxyphenyl)ethanol | ≥95% | CAS 829-19-6 | C10H14O3 | 500mg
1-(2 4-Dimethoxyphenyl)ethanol | ≥95% | CAS 829-19-6 | C10H14O3 | 500mg
Aobchem Ethyl 2-(2 4-dimethoxyphenyl)-2-oxoacetate | ≥95% | CAS 6592-19-4 | C12H14O5 | 5g
Ethyl 2-(2 4-dimethoxyphenyl)-2-oxoacetate | ≥95% | CAS 6592-19-4 | C12H14O5 | 5g
Aobchem Ethyl 2-(2 4-dimethoxyphenyl)-2-oxoacetate | ≥95% | CAS 6592-19-4 | C12H14O5 | 250mg
Ethyl 2-(2 4-dimethoxyphenyl)-2-oxoacetate | ≥95% | CAS 6592-19-4 | C12H14O5 | 250mg
Aobchem 5-(3 4-Dimethoxyphenyl)-2-pyridinecarboxylic acid | ≥95% | CAS 87789-67-1 | C14H13NO4 | 250mg
5-(3 4-Dimethoxyphenyl)-2-pyridinecarboxylic acid | ≥95% | CAS 87789-67-1 | C14H13NO4 | 250mg
eMolecules 1246888-90-3 | 4-(2,6-Dimethoxyphenyl)-3-(1,1-dimethylethyl)-2,3-dihydro-1,3-benzoxaphosphole | Synthonix - Stock | MFCD30748198 | 330.364 | C19H23O3P | 97.000 | COc1cccc(OC)c1-c1cccc2OCP(c12)C(C)(C)C | 5g | 495867582
4-(2,6-Dimethoxyphenyl)-3-(1,1-dimethylethyl)-2,3-dihydro-1,3-benzoxaphosphole | Synthonix - Stock | 1246888-90-3 | MFCD30748198 | 330.364 | C19H23O3P | 97.000 | COc1cccc(OC)c1-c1cccc2OCP(c12)C(C)(C)C | 5g | 495867582
Aobchem (3-Chloro-2 6-dimethoxyphenyl)boronic acid | ≥97% | CAS 512186-37-7 | C8H10BClO4 | 1g
(3-Chloro-2 6-dimethoxyphenyl)boronic acid | ≥97% | CAS 512186-37-7 | C8H10BClO4 | 1g
Apexbio Technology LLC VX-702 479543-46-9; 745833-23-2 50mg
VX-702 is a small-molecule inhibitor targeting p38 mitogen-activated protein kinase (MAPK) also known as MAPK14 It is designed to inhibit p38 MAPK thereby regulating cellular responses to cytokine signaling and various stressors VX-702 exerts its biological activity primarily through ATP-competitive inhibition In experimental models VX-702 demonstrates potent inhibition with reported IC50 values ranging from 4 to 20 nM Based on these pharmacological properties VX-702 holds research potential in the study of p38 MAPK-dependent pathways platelet storage lesions and renal excretion mechanisms
Aobchem 1-(3 5-Dimethoxyphenyl)-2 2 2-trifluoroethanone | ≥97% | CAS 929099-06-9 | C10H9F3O3 | 1g
1-(3 5-Dimethoxyphenyl)-2 2 2-trifluoroethanone | ≥97% | CAS 929099-06-9 | C10H9F3O3 | 1g
Aobchem (3-Fluoro-4 5-dimethoxyphenyl)boronic acid | ≥95% | CAS 1840935-37-6 | C8H10BFO4 | 1g
(3-Fluoro-4 5-dimethoxyphenyl)boronic acid | ≥95% | CAS 1840935-37-6 | C8H10BFO4 | 1g
